C19H31FN2O — CID 110353499
N-[2-(dimethylamino)-2-methylpropyl]-3-(4-fluoro-3-methylphenyl)-4-methylpentanamide (PubChem CID 110353499) has the molecular formula C19H31FN2O and a molecular weight of 322.47 g/mol. Its IUPAC name is N-[2-(dimethylamino)-2-methylpropyl]-3-(4-fluoro-3-methylphenyl)-4-methylpentanamide.
| Compound Name | N-[2-(dimethylamino)-2-methylpropyl]-3-(4-fluoro-3-methylphenyl)-4-methylpentanamide |
|---|---|
| PubChem CID | 110353499 |
| Molecular Formula | C19H31FN2O |
| Molecular Weight | 322.47 g/mol |
| Exact Mass | 322.24 |
| IUPAC Name | N-[2-(dimethylamino)-2-methylpropyl]-3-(4-fluoro-3-methylphenyl)-4-methylpentanamide |
| SMILES | Cc1cc(C(CC(=O)NCC(C)(C)N(C)C)C(C)C)ccc1F |
| InChI | InChI=1S/C19H31FN2O/c1-13(2)16(15-8-9-17(20)14(3)10-15)11-18(23)21-12-19(4,5)22(6)7/h8-10,13,16H,11-12H2,1-7H3,(H,21,23) |
| InChIKey | PKMRYARXYWBMHC-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.47 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |