C22H25FO3S — CID 70518909
4-[3-[2-(4-fluoro-3-methylphenyl)-4,6-dimethylphenyl]prop-2-enylsulfanyl]-3-hydroxybutanoic acid (PubChem CID 70518909) has the molecular formula C22H25FO3S and a molecular weight of 388.50 g/mol. Its IUPAC name is 4-[3-[2-(4-fluoro-3-methylphenyl)-4,6-dimethylphenyl]prop-2-enylsulfanyl]-3-hydroxybutanoic acid.
| Compound Name | 4-[3-[2-(4-fluoro-3-methylphenyl)-4,6-dimethylphenyl]prop-2-enylsulfanyl]-3-hydroxybutanoic acid |
|---|---|
| PubChem CID | 70518909 |
| Molecular Formula | C22H25FO3S |
| Molecular Weight | 388.50 g/mol |
| Exact Mass | 388.15 |
| IUPAC Name | 4-[3-[2-(4-fluoro-3-methylphenyl)-4,6-dimethylphenyl]prop-2-enylsulfanyl]-3-hydroxybutanoic acid |
| SMILES | Cc1cc(C)c(C=CCSCC(O)CC(=O)O)c(-c2ccc(F)c(C)c2)c1 |
| InChI | InChI=1S/C22H25FO3S/c1-14-9-15(2)19(5-4-8-27-13-18(24)12-22(25)26)20(10-14)17-6-7-21(23)16(3)11-17/h4-7,9-11,18,24H,8,12-13H2,1-3H3,(H,25,26) |
| InChIKey | NXVFMGROYDKALR-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.50 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|