C26H32FNO5 — CID 57233076
2-acetamidoethyl (3R,5S)-7-[2-(4-fluoro-3-methylphenyl)-4,6-dimethylphenyl]-3,5-dihydroxyhept-6-enoate (PubChem CID 57233076) has the molecular formula C26H32FNO5 and a molecular weight of 457.54 g/mol. Its IUPAC name is 2-acetamidoethyl (3R,5S)-7-[2-(4-fluoro-3-methylphenyl)-4,6-dimethylphenyl]-3,5-dihydroxyhept-6-enoate.
| Compound Name | 2-acetamidoethyl (3R,5S)-7-[2-(4-fluoro-3-methylphenyl)-4,6-dimethylphenyl]-3,5-dihydroxyhept-6-enoate |
|---|---|
| PubChem CID | 57233076 |
| Molecular Formula | C26H32FNO5 |
| Molecular Weight | 457.54 g/mol |
| Exact Mass | 457.23 |
| IUPAC Name | 2-acetamidoethyl (3R,5S)-7-[2-(4-fluoro-3-methylphenyl)-4,6-dimethylphenyl]-3,5-dihydroxyhept-6-enoate |
| SMILES | CC(=O)NCCOC(=O)C[C@H](O)C[C@H](O)C=Cc1c(C)cc(C)cc1-c1ccc(F)c(C)c1 |
| InChI | InChI=1S/C26H32FNO5/c1-16-11-17(2)23(24(12-16)20-5-8-25(27)18(3)13-20)7-6-21(30)14-22(31)15-26(32)33-10-9-28-19(4)29/h5-8,11-13,21-22,30-31H,9-10,14-15H2,1-4H3,(H,28,29)/t21-,22-/m1/s1 |
| InChIKey | BLJLNWHSXXJROW-FGZHOGPDSA-N |
| XLogP | 3.61 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.54 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|