C24H33FO4 — CID 22847687
(E,3R,5S)-7-[2-(4-fluoro-3-methylphenyl)-4,4,6,6-tetramethylcyclohexen-1-yl]-3,5-dihydroxyhept-6-enoic acid (PubChem CID 22847687) has the molecular formula C24H33FO4 and a molecular weight of 404.52 g/mol. Its IUPAC name is (E,3R,5S)-7-[2-(4-fluoro-3-methylphenyl)-4,4,6,6-tetramethylcyclohexen-1-yl]-3,5-dihydroxyhept-6-enoic acid.
| Compound Name | (E,3R,5S)-7-[2-(4-fluoro-3-methylphenyl)-4,4,6,6-tetramethylcyclohexen-1-yl]-3,5-dihydroxyhept-6-enoic acid |
|---|---|
| PubChem CID | 22847687 |
| Molecular Formula | C24H33FO4 |
| Molecular Weight | 404.52 g/mol |
| Exact Mass | 404.24 |
| IUPAC Name | (E,3R,5S)-7-[2-(4-fluoro-3-methylphenyl)-4,4,6,6-tetramethylcyclohexen-1-yl]-3,5-dihydroxyhept-6-enoic acid |
| SMILES | Cc1cc(C2=C(/C=C/[C@@H](O)C[C@@H](O)CC(=O)O)C(C)(C)CC(C)(C)C2)ccc1F |
| InChI | InChI=1S/C24H33FO4/c1-15-10-16(6-9-21(15)25)19-13-23(2,3)14-24(4,5)20(19)8-7-17(26)11-18(27)12-22(28)29/h6-10,17-18,26-27H,11-14H2,1-5H3,(H,28,29)/b8-7+/t17-,18-/m1/s1 |
| InChIKey | ZZIWKZGLXPJEJV-HNGSOEQISA-N |
| XLogP | 4.88 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.52 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |