C22H28FLi2O5P — CID 67925065
dilithium;(3S)-4-[2-[2-(4-fluorophenyl)-4,4,6,6-tetramethylcyclohexen-1-yl]ethenyl-oxidophosphoryl]-3-hydroxybutanoate (PubChem CID 67925065) has the molecular formula C22H28FLi2O5P and a molecular weight of 436.32 g/mol. Its IUPAC name is dilithium;(3S)-4-[2-[2-(4-fluorophenyl)-4,4,6,6-tetramethylcyclohexen-1-yl]ethenyl-oxidophosphoryl]-3-hydroxybutanoate.
| Compound Name | dilithium;(3S)-4-[2-[2-(4-fluorophenyl)-4,4,6,6-tetramethylcyclohexen-1-yl]ethenyl-oxidophosphoryl]-3-hydroxybutanoate |
|---|---|
| PubChem CID | 67925065 |
| Molecular Formula | C22H28FLi2O5P |
| Molecular Weight | 436.32 g/mol |
| Exact Mass | 436.20 |
| IUPAC Name | dilithium;(3S)-4-[2-[2-(4-fluorophenyl)-4,4,6,6-tetramethylcyclohexen-1-yl]ethenyl-oxidophosphoryl]-3-hydroxybutanoate |
| SMILES | CC1(C)CC(c2ccc(F)cc2)=C(C=CP(=O)([O-])C[C@@H](O)CC(=O)[O-])C(C)(C)C1.[Li+].[Li+] |
| InChI | InChI=1S/C22H30FO5P.2Li/c1-21(2)12-18(15-5-7-16(23)8-6-15)19(22(3,4)14-21)9-10-29(27,28)13-17(24)11-20(25)26;;/h5-10,17,24H,11-14H2,1-4H3,(H,25,26)(H,27,28);;/q;2*+1/p-2/t17-;;/m0../s1 |
| InChIKey | CCDUXZMQFUWZPC-RMRYJAPISA-L |
| XLogP | -2.91 |
| TPSA | 100.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.32 |
| LogP ≤ 5 | -2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|