C23H23FNNaO4 — CID 76963097
sodium (E,3S,5R)-7-[1-ethyl-3-(4-fluorophenyl)indol-2-yl]-3,5-dihydroxyhept-6-enoate (PubChem CID 76963097) has the molecular formula C23H23FNNaO4 and a molecular weight of 419.43 g/mol. Its IUPAC name is sodium (E,3S,5R)-7-[1-ethyl-3-(4-fluorophenyl)indol-2-yl]-3,5-dihydroxyhept-6-enoate.
| Compound Name | sodium (E,3S,5R)-7-[1-ethyl-3-(4-fluorophenyl)indol-2-yl]-3,5-dihydroxyhept-6-enoate |
|---|---|
| PubChem CID | 76963097 |
| Molecular Formula | C23H23FNNaO4 |
| Molecular Weight | 419.43 g/mol |
| Exact Mass | 419.15 |
| IUPAC Name | sodium (E,3S,5R)-7-[1-ethyl-3-(4-fluorophenyl)indol-2-yl]-3,5-dihydroxyhept-6-enoate |
| SMILES | CCn1c(/C=C/[C@H](O)C[C@H](O)CC(=O)[O-])c(-c2ccc(F)cc2)c2ccccc21.[Na+] |
| InChI | InChI=1S/C23H24FNO4.Na/c1-2-25-20-6-4-3-5-19(20)23(15-7-9-16(24)10-8-15)21(25)12-11-17(26)13-18(27)14-22(28)29;/h3-12,17-18,26-27H,2,13-14H2,1H3,(H,28,29);/q;+1/p-1/b12-11+;/t17-,18-;/m0./s1 |
| InChIKey | KTBBQAQDAUENCT-YEAYBMRSSA-M |
| XLogP | -0.26 |
| TPSA | 85.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.43 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |