C26H30F2O4 — CID 88615212
(E,3R,5S)-8-[bis(4-fluoro-3-methylphenyl)methylidene]-3,5-dihydroxy-9-methyldec-6-enoic acid (PubChem CID 88615212) has the molecular formula C26H30F2O4 and a molecular weight of 444.52 g/mol. Its IUPAC name is (E,3R,5S)-8-[bis(4-fluoro-3-methylphenyl)methylidene]-3,5-dihydroxy-9-methyldec-6-enoic acid.
| Compound Name | (E,3R,5S)-8-[bis(4-fluoro-3-methylphenyl)methylidene]-3,5-dihydroxy-9-methyldec-6-enoic acid |
|---|---|
| PubChem CID | 88615212 |
| Molecular Formula | C26H30F2O4 |
| Molecular Weight | 444.52 g/mol |
| Exact Mass | 444.21 |
| IUPAC Name | (E,3R,5S)-8-[bis(4-fluoro-3-methylphenyl)methylidene]-3,5-dihydroxy-9-methyldec-6-enoic acid |
| SMILES | Cc1cc(C(=C(/C=C/[C@@H](O)C[C@@H](O)CC(=O)O)C(C)C)c2ccc(F)c(C)c2)ccc1F |
| InChI | InChI=1S/C26H30F2O4/c1-15(2)22(8-7-20(29)13-21(30)14-25(31)32)26(18-5-9-23(27)16(3)11-18)19-6-10-24(28)17(4)12-19/h5-12,15,20-21,29-30H,13-14H2,1-4H3,(H,31,32)/b8-7+/t20-,21-/m1/s1 |
| InChIKey | GPKKKJYMEMWZAA-DVFFMCNPSA-N |
| XLogP | 5.18 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.52 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|