C32H47FO4 — CID 142827772
(5S,6E,8Z,10E)-8-(2,4-dimethylhex-3-en-3-yl)-9-(4-fluorophenyl)-3,5-dihydroxy-11,12-dimethyl-10-propyltrideca-6,8,10-trienoic acid (PubChem CID 142827772) has the molecular formula C32H47FO4 and a molecular weight of 514.72 g/mol. Its IUPAC name is (5S,6E,8Z,10E)-8-(2,4-dimethylhex-3-en-3-yl)-9-(4-fluorophenyl)-3,5-dihydroxy-11,12-dimethyl-10-propyltrideca-6,8,10-trienoic acid.
| Compound Name | (5S,6E,8Z,10E)-8-(2,4-dimethylhex-3-en-3-yl)-9-(4-fluorophenyl)-3,5-dihydroxy-11,12-dimethyl-10-propyltrideca-6,8,10-trienoic acid |
|---|---|
| PubChem CID | 142827772 |
| Molecular Formula | C32H47FO4 |
| Molecular Weight | 514.72 g/mol |
| Exact Mass | 514.35 |
| IUPAC Name | (5S,6E,8Z,10E)-8-(2,4-dimethylhex-3-en-3-yl)-9-(4-fluorophenyl)-3,5-dihydroxy-11,12-dimethyl-10-propyltrideca-6,8,10-trienoic acid |
| SMILES | CCCC(/C(=C(/C=C/[C@@H](O)CC(O)CC(=O)O)C(=C(C)CC)C(C)C)c1ccc(F)cc1)=C(/C)C(C)C |
| InChI | InChI=1S/C32H47FO4/c1-9-11-28(23(8)20(3)4)32(24-12-14-25(33)15-13-24)29(31(21(5)6)22(7)10-2)17-16-26(34)18-27(35)19-30(36)37/h12-17,20-21,26-27,34-35H,9-11,18-19H2,1-8H3,(H,36,37)/b17-16+,28-23+,31-22?,32-29-/t26-,27?/m1/s1 |
| InChIKey | NYXNWPGEJGUZNE-HPXTYYFSSA-N |
| XLogP | 7.88 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.72 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|