C22H21F2O4- — CID 91928898
(3R,5S,6E)-9,9-bis(4-fluorophenyl)-3,5-dihydroxy-8-methylnona-6,8-dienoate (PubChem CID 91928898) has the molecular formula C22H21F2O4- and a molecular weight of 387.40 g/mol. Its IUPAC name is (3R,5S,6E)-9,9-bis(4-fluorophenyl)-3,5-dihydroxy-8-methylnona-6,8-dienoate.
| Compound Name | (3R,5S,6E)-9,9-bis(4-fluorophenyl)-3,5-dihydroxy-8-methylnona-6,8-dienoate |
|---|---|
| PubChem CID | 91928898 |
| Molecular Formula | C22H21F2O4- |
| Molecular Weight | 387.40 g/mol |
| Exact Mass | 387.14 |
| IUPAC Name | (3R,5S,6E)-9,9-bis(4-fluorophenyl)-3,5-dihydroxy-8-methylnona-6,8-dienoate |
| SMILES | CC(/C=C/[C@@H](O)C[C@@H](O)CC(=O)[O-])=C(c1ccc(F)cc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C22H22F2O4/c1-14(2-11-19(25)12-20(26)13-21(27)28)22(15-3-7-17(23)8-4-15)16-5-9-18(24)10-6-16/h2-11,19-20,25-26H,12-13H2,1H3,(H,27,28)/p-1/b11-2+/t19-,20-/m1/s1 |
| InChIKey | HFIHSHWOSGBLEQ-VPBDITOFSA-M |
| XLogP | 2.59 |
| TPSA | 80.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.40 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|