C33H31F2NO3S — CID 88526290
(3R,5S,6E)-9,9-bis(4-fluorophenyl)-3,5-dihydroxy-N-[(1R)-1-phenylethyl]-8-thiophen-2-ylnona-6,8-dienamide (PubChem CID 88526290) has the molecular formula C33H31F2NO3S and a molecular weight of 559.68 g/mol. Its IUPAC name is (3R,5S,6E)-9,9-bis(4-fluorophenyl)-3,5-dihydroxy-N-[(1R)-1-phenylethyl]-8-thiophen-2-ylnona-6,8-dienamide.
| Compound Name | (3R,5S,6E)-9,9-bis(4-fluorophenyl)-3,5-dihydroxy-N-[(1R)-1-phenylethyl]-8-thiophen-2-ylnona-6,8-dienamide |
|---|---|
| PubChem CID | 88526290 |
| Molecular Formula | C33H31F2NO3S |
| Molecular Weight | 559.68 g/mol |
| Exact Mass | 559.20 |
| IUPAC Name | (3R,5S,6E)-9,9-bis(4-fluorophenyl)-3,5-dihydroxy-N-[(1R)-1-phenylethyl]-8-thiophen-2-ylnona-6,8-dienamide |
| SMILES | C[C@@H](NC(=O)C[C@H](O)C[C@H](O)/C=C/C(=C(c1ccc(F)cc1)c1ccc(F)cc1)c1cccs1)c1ccccc1 |
| InChI | InChI=1S/C33H31F2NO3S/c1-22(23-6-3-2-4-7-23)36-32(39)21-29(38)20-28(37)17-18-30(31-8-5-19-40-31)33(24-9-13-26(34)14-10-24)25-11-15-27(35)16-12-25/h2-19,22,28-29,37-38H,20-21H2,1H3,(H,36,39)/b18-17+/t22-,28-,29-/m1/s1 |
| InChIKey | PSNXVFFNDQIVNZ-PFDSSHEBSA-N |
| XLogP | 6.92 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.68 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|