C14H20NO3Y- — CID 59712847
(3S,5S)-3,5-dihydroxy-N-[(1S)-1-phenylethyl]hexanamide;yttrium (PubChem CID 59712847) has the molecular formula C14H20NO3Y- and a molecular weight of 339.22 g/mol. Its IUPAC name is (3S,5S)-3,5-dihydroxy-N-[(1S)-1-phenylethyl]hexanamide;yttrium.
| Compound Name | (3S,5S)-3,5-dihydroxy-N-[(1S)-1-phenylethyl]hexanamide;yttrium |
|---|---|
| PubChem CID | 59712847 |
| Molecular Formula | C14H20NO3Y- |
| Molecular Weight | 339.22 g/mol |
| Exact Mass | 339.05 |
| IUPAC Name | (3S,5S)-3,5-dihydroxy-N-[(1S)-1-phenylethyl]hexanamide;yttrium |
| SMILES | [CH2-][C@H](O)C[C@H](O)CC(=O)N[C@@H](C)c1ccccc1.[Y] |
| InChI | InChI=1S/C14H20NO3.Y/c1-10(16)8-13(17)9-14(18)15-11(2)12-6-4-3-5-7-12;/h3-7,10-11,13,16-17H,1,8-9H2,2H3,(H,15,18);/q-1;/t10-,11-,13-;/m0./s1 |
| InChIKey | WHXHNZRFHPPRJI-SQRKDXEHSA-N |
| XLogP | 1.20 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.22 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|