C21H24FN2NaO4 — CID 23665088
sodium (E,3R,5S)-7-[2-(4-fluorophenyl)-7-methyl-4,5,6,7-tetrahydroindazol-3-yl]-3,5-dihydroxyhept-6-enoate (PubChem CID 23665088) has the molecular formula C21H24FN2NaO4 and a molecular weight of 410.42 g/mol. Its IUPAC name is sodium (E,3R,5S)-7-[2-(4-fluorophenyl)-7-methyl-4,5,6,7-tetrahydroindazol-3-yl]-3,5-dihydroxyhept-6-enoate.
| Compound Name | sodium (E,3R,5S)-7-[2-(4-fluorophenyl)-7-methyl-4,5,6,7-tetrahydroindazol-3-yl]-3,5-dihydroxyhept-6-enoate |
|---|---|
| PubChem CID | 23665088 |
| Molecular Formula | C21H24FN2NaO4 |
| Molecular Weight | 410.42 g/mol |
| Exact Mass | 410.16 |
| IUPAC Name | sodium (E,3R,5S)-7-[2-(4-fluorophenyl)-7-methyl-4,5,6,7-tetrahydroindazol-3-yl]-3,5-dihydroxyhept-6-enoate |
| SMILES | CC1CCCc2c1nn(-c1ccc(F)cc1)c2/C=C/[C@@H](O)C[C@@H](O)CC(=O)[O-].[Na+] |
| InChI | InChI=1S/C21H25FN2O4.Na/c1-13-3-2-4-18-19(10-9-16(25)11-17(26)12-20(27)28)24(23-21(13)18)15-7-5-14(22)6-8-15;/h5-10,13,16-17,25-26H,2-4,11-12H2,1H3,(H,27,28);/q;+1/p-1/b10-9+;/t13?,16-,17-;/m1./s1 |
| InChIKey | ILCRKQUEFJBZOU-QRYQHUSVSA-M |
| XLogP | -1.28 |
| TPSA | 98.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.42 |
| LogP ≤ 5 | -1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |