C26H32FN2NaO4 — CID 23665083
sodium (E,3R,5S)-7-[7-cyclohexyl-2-(4-fluorophenyl)-4,5,6,7-tetrahydroindazol-3-yl]-3,5-dihydroxyhept-6-enoate (PubChem CID 23665083) has the molecular formula C26H32FN2NaO4 and a molecular weight of 478.54 g/mol. Its IUPAC name is sodium (E,3R,5S)-7-[7-cyclohexyl-2-(4-fluorophenyl)-4,5,6,7-tetrahydroindazol-3-yl]-3,5-dihydroxyhept-6-enoate.
| Compound Name | sodium (E,3R,5S)-7-[7-cyclohexyl-2-(4-fluorophenyl)-4,5,6,7-tetrahydroindazol-3-yl]-3,5-dihydroxyhept-6-enoate |
|---|---|
| PubChem CID | 23665083 |
| Molecular Formula | C26H32FN2NaO4 |
| Molecular Weight | 478.54 g/mol |
| Exact Mass | 478.22 |
| IUPAC Name | sodium (E,3R,5S)-7-[7-cyclohexyl-2-(4-fluorophenyl)-4,5,6,7-tetrahydroindazol-3-yl]-3,5-dihydroxyhept-6-enoate |
| SMILES | O=C([O-])C[C@H](O)C[C@H](O)/C=C/c1c2c(nn1-c1ccc(F)cc1)C(C1CCCCC1)CCC2.[Na+] |
| InChI | InChI=1S/C26H33FN2O4.Na/c27-18-9-11-19(12-10-18)29-24(14-13-20(30)15-21(31)16-25(32)33)23-8-4-7-22(26(23)28-29)17-5-2-1-3-6-17;/h9-14,17,20-22,30-31H,1-8,15-16H2,(H,32,33);/q;+1/p-1/b14-13+;/t20-,21-,22?;/m1./s1 |
| InChIKey | IBSPPNJAHFIKNV-WSKRVYPCSA-M |
| XLogP | 0.28 |
| TPSA | 98.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.54 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |