C26H28F2N4O6 — CID 14723972
(6E)-9,9-bis(4-fluorophenyl)-3,5-dihydroxy-8-[1-(2-methoxyethoxymethyl)tetrazol-5-yl]nona-6,8-dienoic acid (PubChem CID 14723972) has the molecular formula C26H28F2N4O6 and a molecular weight of 530.53 g/mol. Its IUPAC name is (6E)-9,9-bis(4-fluorophenyl)-3,5-dihydroxy-8-[1-(2-methoxyethoxymethyl)tetrazol-5-yl]nona-6,8-dienoic acid.
| Compound Name | (6E)-9,9-bis(4-fluorophenyl)-3,5-dihydroxy-8-[1-(2-methoxyethoxymethyl)tetrazol-5-yl]nona-6,8-dienoic acid |
|---|---|
| PubChem CID | 14723972 |
| Molecular Formula | C26H28F2N4O6 |
| Molecular Weight | 530.53 g/mol |
| Exact Mass | 530.20 |
| IUPAC Name | (6E)-9,9-bis(4-fluorophenyl)-3,5-dihydroxy-8-[1-(2-methoxyethoxymethyl)tetrazol-5-yl]nona-6,8-dienoic acid |
| SMILES | COCCOCn1nnnc1C(/C=C/C(O)CC(O)CC(=O)O)=C(c1ccc(F)cc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C26H28F2N4O6/c1-37-12-13-38-16-32-26(29-30-31-32)23(11-10-21(33)14-22(34)15-24(35)36)25(17-2-6-19(27)7-3-17)18-4-8-20(28)9-5-18/h2-11,21-22,33-34H,12-16H2,1H3,(H,35,36)/b11-10+ |
| InChIKey | PDWILZRNHFMNJT-ZHACJKMWSA-N |
| XLogP | 2.67 |
| TPSA | 139.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.53 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|