C26H26F2N4O4 — CID 172718842
12,12-bis(4-fluorophenyl)-4,6-dihydroxy-11-(1-methyltetrazol-5-yl)dodeca-7,9,11-trienoic acid (PubChem CID 172718842) has the molecular formula C26H26F2N4O4 and a molecular weight of 496.51 g/mol. Its IUPAC name is 12,12-bis(4-fluorophenyl)-4,6-dihydroxy-11-(1-methyltetrazol-5-yl)dodeca-7,9,11-trienoic acid.
| Compound Name | 12,12-bis(4-fluorophenyl)-4,6-dihydroxy-11-(1-methyltetrazol-5-yl)dodeca-7,9,11-trienoic acid |
|---|---|
| PubChem CID | 172718842 |
| Molecular Formula | C26H26F2N4O4 |
| Molecular Weight | 496.51 g/mol |
| Exact Mass | 496.19 |
| IUPAC Name | 12,12-bis(4-fluorophenyl)-4,6-dihydroxy-11-(1-methyltetrazol-5-yl)dodeca-7,9,11-trienoic acid |
| SMILES | Cn1nnnc1C(C=CC=CC(O)CC(O)CCC(=O)O)=C(c1ccc(F)cc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C26H26F2N4O4/c1-32-26(29-30-31-32)23(5-3-2-4-21(33)16-22(34)14-15-24(35)36)25(17-6-10-19(27)11-7-17)18-8-12-20(28)13-9-18/h2-13,21-22,33-34H,14-16H2,1H3,(H,35,36) |
| InChIKey | GFNQZJGWZKHLPS-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 121.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.51 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|