C16H22FNO3 — CID 82322745
4-(4-fluoro-3-methylphenyl)-3-(3-methylbutylamino)-4-oxobutanoic acid (PubChem CID 82322745) has the molecular formula C16H22FNO3 and a molecular weight of 295.35 g/mol. Its IUPAC name is 4-(4-fluoro-3-methylphenyl)-3-(3-methylbutylamino)-4-oxobutanoic acid.
| Compound Name | 4-(4-fluoro-3-methylphenyl)-3-(3-methylbutylamino)-4-oxobutanoic acid |
|---|---|
| PubChem CID | 82322745 |
| Molecular Formula | C16H22FNO3 |
| Molecular Weight | 295.35 g/mol |
| Exact Mass | 295.16 |
| IUPAC Name | 4-(4-fluoro-3-methylphenyl)-3-(3-methylbutylamino)-4-oxobutanoic acid |
| SMILES | Cc1cc(C(=O)C(CC(=O)O)NCCC(C)C)ccc1F |
| InChI | InChI=1S/C16H22FNO3/c1-10(2)6-7-18-14(9-15(19)20)16(21)12-4-5-13(17)11(3)8-12/h4-5,8,10,14,18H,6-7,9H2,1-3H3,(H,19,20) |
| InChIKey | CQIKKFPFAZDATP-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.35 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |