C14H17F2NO4 — CID 82322860
4-(3,4-difluorophenyl)-3-(3-methoxypropylamino)-4-oxobutanoic acid (PubChem CID 82322860) has the molecular formula C14H17F2NO4 and a molecular weight of 301.29 g/mol. Its IUPAC name is 4-(3,4-difluorophenyl)-3-(3-methoxypropylamino)-4-oxobutanoic acid.
| Compound Name | 4-(3,4-difluorophenyl)-3-(3-methoxypropylamino)-4-oxobutanoic acid |
|---|---|
| PubChem CID | 82322860 |
| Molecular Formula | C14H17F2NO4 |
| Molecular Weight | 301.29 g/mol |
| Exact Mass | 301.11 |
| IUPAC Name | 4-(3,4-difluorophenyl)-3-(3-methoxypropylamino)-4-oxobutanoic acid |
| SMILES | COCCCNC(CC(=O)O)C(=O)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C14H17F2NO4/c1-21-6-2-5-17-12(8-13(18)19)14(20)9-3-4-10(15)11(16)7-9/h3-4,7,12,17H,2,5-6,8H2,1H3,(H,18,19) |
| InChIKey | RKXCEXLWTMLTRP-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.29 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|