C13H17F2NO4 — CID 82349409
4-(2,5-difluorophenyl)-4-hydroxy-3-(2-methoxyethylamino)butanoic acid (PubChem CID 82349409) has the molecular formula C13H17F2NO4 and a molecular weight of 289.28 g/mol. Its IUPAC name is 4-(2,5-difluorophenyl)-4-hydroxy-3-(2-methoxyethylamino)butanoic acid.
| Compound Name | 4-(2,5-difluorophenyl)-4-hydroxy-3-(2-methoxyethylamino)butanoic acid |
|---|---|
| PubChem CID | 82349409 |
| Molecular Formula | C13H17F2NO4 |
| Molecular Weight | 289.28 g/mol |
| Exact Mass | 289.11 |
| IUPAC Name | 4-(2,5-difluorophenyl)-4-hydroxy-3-(2-methoxyethylamino)butanoic acid |
| SMILES | COCCNC(CC(=O)O)C(O)c1cc(F)ccc1F |
| InChI | InChI=1S/C13H17F2NO4/c1-20-5-4-16-11(7-12(17)18)13(19)9-6-8(14)2-3-10(9)15/h2-3,6,11,13,16,19H,4-5,7H2,1H3,(H,17,18) |
| InChIKey | ULTZLSFEYOLOIM-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.28 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|