C13H17F2NO4 — CID 140922985
N-[(1R,2S,4S)-1-(2,5-difluorophenyl)-1,4,5-trihydroxypentan-2-yl]acetamide (PubChem CID 140922985) has the molecular formula C13H17F2NO4 and a molecular weight of 289.28 g/mol. Its IUPAC name is N-[(1R,2S,4S)-1-(2,5-difluorophenyl)-1,4,5-trihydroxypentan-2-yl]acetamide.
| Compound Name | N-[(1R,2S,4S)-1-(2,5-difluorophenyl)-1,4,5-trihydroxypentan-2-yl]acetamide |
|---|---|
| PubChem CID | 140922985 |
| Molecular Formula | C13H17F2NO4 |
| Molecular Weight | 289.28 g/mol |
| Exact Mass | 289.11 |
| IUPAC Name | N-[(1R,2S,4S)-1-(2,5-difluorophenyl)-1,4,5-trihydroxypentan-2-yl]acetamide |
| SMILES | CC(=O)N[C@@H](C[C@H](O)CO)[C@H](O)c1cc(F)ccc1F |
| InChI | InChI=1S/C13H17F2NO4/c1-7(18)16-12(5-9(19)6-17)13(20)10-4-8(14)2-3-11(10)15/h2-4,9,12-13,17,19-20H,5-6H2,1H3,(H,16,18)/t9-,12-,13+/m0/s1 |
| InChIKey | XMMOHJUIWPWKDJ-TVYUQYBPSA-N |
| XLogP | 0.25 |
| TPSA | 89.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.28 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |