C15H19F2NO5 — CID 135350892
[2-acetamido-1-(2,5-difluorophenyl)-4,5-dihydroxypentyl] acetate (PubChem CID 135350892) has the molecular formula C15H19F2NO5 and a molecular weight of 331.32 g/mol. Its IUPAC name is [2-acetamido-1-(2,5-difluorophenyl)-4,5-dihydroxypentyl] acetate.
| Compound Name | [2-acetamido-1-(2,5-difluorophenyl)-4,5-dihydroxypentyl] acetate |
|---|---|
| PubChem CID | 135350892 |
| Molecular Formula | C15H19F2NO5 |
| Molecular Weight | 331.32 g/mol |
| Exact Mass | 331.12 |
| IUPAC Name | [2-acetamido-1-(2,5-difluorophenyl)-4,5-dihydroxypentyl] acetate |
| SMILES | CC(=O)NC(CC(O)CO)C(OC(C)=O)c1cc(F)ccc1F |
| InChI | InChI=1S/C15H19F2NO5/c1-8(20)18-14(6-11(22)7-19)15(23-9(2)21)12-5-10(16)3-4-13(12)17/h3-5,11,14-15,19,22H,6-7H2,1-2H3,(H,18,20) |
| InChIKey | MPAZQVUEAOARLC-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.32 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |