4-(3,4-difluorophenyl)-4-oxo-3-(propan-2-ylamino)butanoic acid

C13H15F2NO3 — CID 82322868

IUPAC4-(3,4-difluorophenyl)-4-oxo-3-(propan-2-ylamino)butanoic acid
SMILESCC(C)NC(CC(=O)O)C(=O)c1ccc(F)c(F)c1
InChIInChI=1S/C13H15F2NO3/c1-7(2)16-11(6-12(17)18)13(19)8-3-4-9(14)10(15)5-8/h3-5,7,11,16H,6H2,1-2H3,(H,17,18)
InChIKeyCLGXZBRVONDOHQ-UHFFFAOYSA-N
MW271.26 g/mol
LogP1.99
Rot. Bonds6

About 4-(3,4-difluorophenyl)-4-oxo-3-(propan-2-ylamino)butanoic acid

4-(3,4-difluorophenyl)-4-oxo-3-(propan-2-ylamino)butanoic acid (PubChem CID 82322868) has the molecular formula C13H15F2NO3 and a molecular weight of 271.26 g/mol. Its IUPAC name is 4-(3,4-difluorophenyl)-4-oxo-3-(propan-2-ylamino)butanoic acid.

Molecular Properties

Compound Name4-(3,4-difluorophenyl)-4-oxo-3-(propan-2-ylamino)butanoic acid
PubChem CID82322868
Molecular FormulaC13H15F2NO3
Molecular Weight271.26 g/mol
Exact Mass271.10
IUPAC Name4-(3,4-difluorophenyl)-4-oxo-3-(propan-2-ylamino)butanoic acid
SMILESCC(C)NC(CC(=O)O)C(=O)c1ccc(F)c(F)c1
InChIInChI=1S/C13H15F2NO3/c1-7(2)16-11(6-12(17)18)13(19)8-3-4-9(14)10(15)5-8/h3-5,7,11,16H,6H2,1-2H3,(H,17,18)
InChIKeyCLGXZBRVONDOHQ-UHFFFAOYSA-N
XLogP1.99
TPSA66.40 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds6
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500271.26
LogP ≤ 51.99
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 4-(3,4-difluorophenyl)-4-oxo-3-(propan-2-ylamino)butanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(3,4-difluorophenyl)-4-oxo-3-(propan-2-ylamino)butanoic acid?
The IUPAC name of 4-(3,4-difluorophenyl)-4-oxo-3-(propan-2-ylamino)butanoic acid (CID 82322868) is 4-(3,4-difluorophenyl)-4-oxo-3-(propan-2-ylamino)butanoic acid.
What is the SMILES notation for 4-(3,4-difluorophenyl)-4-oxo-3-(propan-2-ylamino)butanoic acid?
The canonical SMILES for 4-(3,4-difluorophenyl)-4-oxo-3-(propan-2-ylamino)butanoic acid is CC(C)NC(CC(=O)O)C(=O)c1ccc(F)c(F)c1.
What is the InChIKey of 4-(3,4-difluorophenyl)-4-oxo-3-(propan-2-ylamino)butanoic acid?
The InChIKey is CLGXZBRVONDOHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15F2NO3/c1-7(2)16-11(6-12(17)18)13(19)8-3-4-9(14)10(15)5-8/h3-5,7,11,16H,6H2,1-2H3,(H,17,18).
What are the key properties of 4-(3,4-difluorophenyl)-4-oxo-3-(propan-2-ylamino)butanoic acid?
4-(3,4-difluorophenyl)-4-oxo-3-(propan-2-ylamino)butanoic acid has a molecular weight of 271.26 g/mol, XLogP of 1.99, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3,4-difluorophenyl)-4-oxo-3-(propan-2-ylamino)butanoic acid is sourced from PubChem (CID 82322868), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).