C16H23NO4 — CID 82322006
ethyl 3-(3-methoxypropylamino)-4-oxo-4-phenylbutanoate (PubChem CID 82322006) has the molecular formula C16H23NO4 and a molecular weight of 293.36 g/mol. Its IUPAC name is ethyl 3-(3-methoxypropylamino)-4-oxo-4-phenylbutanoate.
| Compound Name | ethyl 3-(3-methoxypropylamino)-4-oxo-4-phenylbutanoate |
|---|---|
| PubChem CID | 82322006 |
| Molecular Formula | C16H23NO4 |
| Molecular Weight | 293.36 g/mol |
| Exact Mass | 293.16 |
| IUPAC Name | ethyl 3-(3-methoxypropylamino)-4-oxo-4-phenylbutanoate |
| SMILES | CCOC(=O)CC(NCCCOC)C(=O)c1ccccc1 |
| InChI | InChI=1S/C16H23NO4/c1-3-21-15(18)12-14(17-10-7-11-20-2)16(19)13-8-5-4-6-9-13/h4-6,8-9,14,17H,3,7,10-12H2,1-2H3 |
| InChIKey | IQOYMALAGZRPAY-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.36 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|