C16H22FNO3 — CID 82322205
ethyl 4-(4-fluoro-3-methylphenyl)-4-oxo-3-(propylamino)butanoate (PubChem CID 82322205) has the molecular formula C16H22FNO3 and a molecular weight of 295.35 g/mol. Its IUPAC name is ethyl 4-(4-fluoro-3-methylphenyl)-4-oxo-3-(propylamino)butanoate.
| Compound Name | ethyl 4-(4-fluoro-3-methylphenyl)-4-oxo-3-(propylamino)butanoate |
|---|---|
| PubChem CID | 82322205 |
| Molecular Formula | C16H22FNO3 |
| Molecular Weight | 295.35 g/mol |
| Exact Mass | 295.16 |
| IUPAC Name | ethyl 4-(4-fluoro-3-methylphenyl)-4-oxo-3-(propylamino)butanoate |
| SMILES | CCCNC(CC(=O)OCC)C(=O)c1ccc(F)c(C)c1 |
| InChI | InChI=1S/C16H22FNO3/c1-4-8-18-14(10-15(19)21-5-2)16(20)12-6-7-13(17)11(3)9-12/h6-7,9,14,18H,4-5,8,10H2,1-3H3 |
| InChIKey | SRTHSDRFCFFOAA-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.35 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |