C26H37FO4 — CID 67923680
7-[4,4-diethyl-2-(4-fluoro-3-methylphenyl)-6,6-dimethylcyclohex-2-en-1-yl]-3,5-dihydroxyhept-6-enoic acid (PubChem CID 67923680) has the molecular formula C26H37FO4 and a molecular weight of 432.58 g/mol. Its IUPAC name is 7-[4,4-diethyl-2-(4-fluoro-3-methylphenyl)-6,6-dimethylcyclohex-2-en-1-yl]-3,5-dihydroxyhept-6-enoic acid.
| Compound Name | 7-[4,4-diethyl-2-(4-fluoro-3-methylphenyl)-6,6-dimethylcyclohex-2-en-1-yl]-3,5-dihydroxyhept-6-enoic acid |
|---|---|
| PubChem CID | 67923680 |
| Molecular Formula | C26H37FO4 |
| Molecular Weight | 432.58 g/mol |
| Exact Mass | 432.27 |
| IUPAC Name | 7-[4,4-diethyl-2-(4-fluoro-3-methylphenyl)-6,6-dimethylcyclohex-2-en-1-yl]-3,5-dihydroxyhept-6-enoic acid |
| SMILES | CCC1(CC)C=C(c2ccc(F)c(C)c2)C(C=CC(O)CC(O)CC(=O)O)C(C)(C)C1 |
| InChI | InChI=1S/C26H37FO4/c1-6-26(7-2)15-21(18-8-11-23(27)17(3)12-18)22(25(4,5)16-26)10-9-19(28)13-20(29)14-24(30)31/h8-12,15,19-20,22,28-29H,6-7,13-14,16H2,1-5H3,(H,30,31) |
| InChIKey | PXRREIZGSOGLIH-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.58 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|