About [2-(4-fluoro-3-methylphenyl)-4,6-dimethylphenyl] acetate
[2-(4-fluoro-3-methylphenyl)-4,6-dimethylphenyl] acetate (PubChem CID 70521640) has the molecular formula C17H17FO2
and a molecular weight of 272.32 g/mol. Its IUPAC name is [2-(4-fluoro-3-methylphenyl)-4,6-dimethylphenyl] acetate.
Molecular Properties
| Compound Name | [2-(4-fluoro-3-methylphenyl)-4,6-dimethylphenyl] acetate |
| PubChem CID | 70521640 |
| Molecular Formula | C17H17FO2 |
| Molecular Weight | 272.32 g/mol |
| Exact Mass | 272.12 |
| IUPAC Name | [2-(4-fluoro-3-methylphenyl)-4,6-dimethylphenyl] acetate |
| SMILES | CC(=O)Oc1c(C)cc(C)cc1-c1ccc(F)c(C)c1 |
| InChI | InChI=1S/C17H17FO2/c1-10-7-12(3)17(20-13(4)19)15(8-10)14-5-6-16(18)11(2)9-14/h5-9H,1-4H3 |
| InChIKey | OCGOOHZEDOTGAD-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.32 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [2-(4-fluoro-3-methylphenyl)-4,6-dimethylphenyl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(4-fluoro-3-methylphenyl)-4,6-dimethylphenyl] acetate?
The IUPAC name of [2-(4-fluoro-3-methylphenyl)-4,6-dimethylphenyl] acetate (CID 70521640) is [2-(4-fluoro-3-methylphenyl)-4,6-dimethylphenyl] acetate.
What is the SMILES notation for [2-(4-fluoro-3-methylphenyl)-4,6-dimethylphenyl] acetate?
The canonical SMILES for [2-(4-fluoro-3-methylphenyl)-4,6-dimethylphenyl] acetate is CC(=O)Oc1c(C)cc(C)cc1-c1ccc(F)c(C)c1.
What is the InChIKey of [2-(4-fluoro-3-methylphenyl)-4,6-dimethylphenyl] acetate?
The InChIKey is OCGOOHZEDOTGAD-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17FO2/c1-10-7-12(3)17(20-13(4)19)15(8-10)14-5-6-16(18)11(2)9-14/h5-9H,1-4H3.
What are the key properties of [2-(4-fluoro-3-methylphenyl)-4,6-dimethylphenyl] acetate?
[2-(4-fluoro-3-methylphenyl)-4,6-dimethylphenyl] acetate has a molecular weight of 272.32 g/mol, XLogP of 4.34, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(4-fluoro-3-methylphenyl)-4,6-dimethylphenyl] acetate is sourced from PubChem (CID 70521640), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).