C22H27FO3S — CID 70517793
methyl 4-[2-[2-(4-fluoro-3-methylphenyl)-4,6-dimethylphenyl]ethylsulfanyl]-3-hydroxybutanoate (PubChem CID 70517793) has the molecular formula C22H27FO3S and a molecular weight of 390.52 g/mol. Its IUPAC name is methyl 4-[2-[2-(4-fluoro-3-methylphenyl)-4,6-dimethylphenyl]ethylsulfanyl]-3-hydroxybutanoate.
| Compound Name | methyl 4-[2-[2-(4-fluoro-3-methylphenyl)-4,6-dimethylphenyl]ethylsulfanyl]-3-hydroxybutanoate |
|---|---|
| PubChem CID | 70517793 |
| Molecular Formula | C22H27FO3S |
| Molecular Weight | 390.52 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | methyl 4-[2-[2-(4-fluoro-3-methylphenyl)-4,6-dimethylphenyl]ethylsulfanyl]-3-hydroxybutanoate |
| SMILES | COC(=O)CC(O)CSCCc1c(C)cc(C)cc1-c1ccc(F)c(C)c1 |
| InChI | InChI=1S/C22H27FO3S/c1-14-9-15(2)19(7-8-27-13-18(24)12-22(25)26-4)20(10-14)17-5-6-21(23)16(3)11-17/h5-6,9-11,18,24H,7-8,12-13H2,1-4H3 |
| InChIKey | DRXCJCNNICAGAI-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.52 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|