methyl 3-hydroxy-4-[(2,4,6-trimethylphenyl)methylamino]butanoate

C15H23NO3 — CID 115123341

IUPACmethyl 3-hydroxy-4-[(2,4,6-trimethylphenyl)methylamino]butanoate
SMILESCOC(=O)CC(O)CNCc1c(C)cc(C)cc1C
InChIInChI=1S/C15H23NO3/c1-10-5-11(2)14(12(3)6-10)9-16-8-13(17)7-15(18)19-4/h5-6,13,16-17H,7-9H2,1-4H3
InChIKeyRTJZCWVXDHNMIZ-UHFFFAOYSA-N
MW265.35 g/mol
LogP1.63
Rot. Bonds6

About methyl 3-hydroxy-4-[(2,4,6-trimethylphenyl)methylamino]butanoate

methyl 3-hydroxy-4-[(2,4,6-trimethylphenyl)methylamino]butanoate (PubChem CID 115123341) has the molecular formula C15H23NO3 and a molecular weight of 265.35 g/mol. Its IUPAC name is methyl 3-hydroxy-4-[(2,4,6-trimethylphenyl)methylamino]butanoate.

Molecular Properties

Compound Namemethyl 3-hydroxy-4-[(2,4,6-trimethylphenyl)methylamino]butanoate
PubChem CID115123341
Molecular FormulaC15H23NO3
Molecular Weight265.35 g/mol
Exact Mass265.17
IUPAC Namemethyl 3-hydroxy-4-[(2,4,6-trimethylphenyl)methylamino]butanoate
SMILESCOC(=O)CC(O)CNCc1c(C)cc(C)cc1C
InChIInChI=1S/C15H23NO3/c1-10-5-11(2)14(12(3)6-10)9-16-8-13(17)7-15(18)19-4/h5-6,13,16-17H,7-9H2,1-4H3
InChIKeyRTJZCWVXDHNMIZ-UHFFFAOYSA-N
XLogP1.63
TPSA58.56 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds6
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500265.35
LogP ≤ 51.63
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze methyl 3-hydroxy-4-[(2,4,6-trimethylphenyl)methylamino]butanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 3-hydroxy-4-[(2,4,6-trimethylphenyl)methylamino]butanoate?
The IUPAC name of methyl 3-hydroxy-4-[(2,4,6-trimethylphenyl)methylamino]butanoate (CID 115123341) is methyl 3-hydroxy-4-[(2,4,6-trimethylphenyl)methylamino]butanoate.
What is the SMILES notation for methyl 3-hydroxy-4-[(2,4,6-trimethylphenyl)methylamino]butanoate?
The canonical SMILES for methyl 3-hydroxy-4-[(2,4,6-trimethylphenyl)methylamino]butanoate is COC(=O)CC(O)CNCc1c(C)cc(C)cc1C.
What is the InChIKey of methyl 3-hydroxy-4-[(2,4,6-trimethylphenyl)methylamino]butanoate?
The InChIKey is RTJZCWVXDHNMIZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23NO3/c1-10-5-11(2)14(12(3)6-10)9-16-8-13(17)7-15(18)19-4/h5-6,13,16-17H,7-9H2,1-4H3.
What are the key properties of methyl 3-hydroxy-4-[(2,4,6-trimethylphenyl)methylamino]butanoate?
methyl 3-hydroxy-4-[(2,4,6-trimethylphenyl)methylamino]butanoate has a molecular weight of 265.35 g/mol, XLogP of 1.63, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-hydroxy-4-[(2,4,6-trimethylphenyl)methylamino]butanoate is sourced from PubChem (CID 115123341), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).