C14H21NO4 — CID 115123244
methyl 3-hydroxy-4-(4-methoxy-3,5-dimethylanilino)butanoate (PubChem CID 115123244) has the molecular formula C14H21NO4 and a molecular weight of 267.32 g/mol. Its IUPAC name is methyl 3-hydroxy-4-(4-methoxy-3,5-dimethylanilino)butanoate.
| Compound Name | methyl 3-hydroxy-4-(4-methoxy-3,5-dimethylanilino)butanoate |
|---|---|
| PubChem CID | 115123244 |
| Molecular Formula | C14H21NO4 |
| Molecular Weight | 267.32 g/mol |
| Exact Mass | 267.15 |
| IUPAC Name | methyl 3-hydroxy-4-(4-methoxy-3,5-dimethylanilino)butanoate |
| SMILES | COC(=O)CC(O)CNc1cc(C)c(OC)c(C)c1 |
| InChI | InChI=1S/C14H21NO4/c1-9-5-11(6-10(2)14(9)19-4)15-8-12(16)7-13(17)18-3/h5-6,12,15-16H,7-8H2,1-4H3 |
| InChIKey | JIDSKCZMWCSIAB-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.32 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|