C10H16N2O — CID 115225476
N'-(4-methoxy-3,5-dimethylphenyl)methanediamine (PubChem CID 115225476) has the molecular formula C10H16N2O and a molecular weight of 180.25 g/mol. Its IUPAC name is N'-(4-methoxy-3,5-dimethylphenyl)methanediamine.
| Compound Name | N'-(4-methoxy-3,5-dimethylphenyl)methanediamine |
|---|---|
| PubChem CID | 115225476 |
| Molecular Formula | C10H16N2O |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.13 |
| IUPAC Name | N'-(4-methoxy-3,5-dimethylphenyl)methanediamine |
| SMILES | COc1c(C)cc(NCN)cc1C |
| InChI | InChI=1S/C10H16N2O/c1-7-4-9(12-6-11)5-8(2)10(7)13-3/h4-5,12H,6,11H2,1-3H3 |
| InChIKey | LRLIHNPGWGIFJT-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|