C11H15NO2 — CID 115222701
2-(4-methoxy-3,5-dimethylanilino)acetaldehyde (PubChem CID 115222701) has the molecular formula C11H15NO2 and a molecular weight of 193.25 g/mol. Its IUPAC name is 2-(4-methoxy-3,5-dimethylanilino)acetaldehyde.
| Compound Name | 2-(4-methoxy-3,5-dimethylanilino)acetaldehyde |
|---|---|
| PubChem CID | 115222701 |
| Molecular Formula | C11H15NO2 |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | 2-(4-methoxy-3,5-dimethylanilino)acetaldehyde |
| SMILES | COc1c(C)cc(NCC=O)cc1C |
| InChI | InChI=1S/C11H15NO2/c1-8-6-10(12-4-5-13)7-9(2)11(8)14-3/h5-7,12H,4H2,1-3H3 |
| InChIKey | SUCTWYKQNBSMCX-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|