C14H21NO2 — CID 22905642
N-(4-methoxy-3,5-dimethylphenyl)-2,2-dimethylpropanamide (PubChem CID 22905642) has the molecular formula C14H21NO2 and a molecular weight of 235.33 g/mol. Its IUPAC name is N-(4-methoxy-3,5-dimethylphenyl)-2,2-dimethylpropanamide.
| Compound Name | N-(4-methoxy-3,5-dimethylphenyl)-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 22905642 |
| Molecular Formula | C14H21NO2 |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.16 |
| IUPAC Name | N-(4-methoxy-3,5-dimethylphenyl)-2,2-dimethylpropanamide |
| SMILES | COc1c(C)cc(NC(=O)C(C)(C)C)cc1C |
| InChI | InChI=1S/C14H21NO2/c1-9-7-11(8-10(2)12(9)17-6)15-13(16)14(3,4)5/h7-8H,1-6H3,(H,15,16) |
| InChIKey | TYMAPAJRSVFQMT-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |