C18H19FO — CID 70518405
(E)-3-[2-(4-fluoro-3-methylphenyl)-4,6-dimethylphenyl]prop-1-en-1-ol (PubChem CID 70518405) has the molecular formula C18H19FO and a molecular weight of 270.35 g/mol. Its IUPAC name is (E)-3-[2-(4-fluoro-3-methylphenyl)-4,6-dimethylphenyl]prop-1-en-1-ol.
| Compound Name | (E)-3-[2-(4-fluoro-3-methylphenyl)-4,6-dimethylphenyl]prop-1-en-1-ol |
|---|---|
| PubChem CID | 70518405 |
| Molecular Formula | C18H19FO |
| Molecular Weight | 270.35 g/mol |
| Exact Mass | 270.14 |
| IUPAC Name | (E)-3-[2-(4-fluoro-3-methylphenyl)-4,6-dimethylphenyl]prop-1-en-1-ol |
| SMILES | Cc1cc(C)c(C/C=C/O)c(-c2ccc(F)c(C)c2)c1 |
| InChI | InChI=1S/C18H19FO/c1-12-9-13(2)16(5-4-8-20)17(10-12)15-6-7-18(19)14(3)11-15/h4,6-11,20H,5H2,1-3H3/b8-4+ |
| InChIKey | MTUMNTHTWNZUEK-XBXARRHUSA-N |
| XLogP | 5.03 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.35 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|