C15H14F2O — CID 172876855
[4-(3,4-difluorophenyl)-2,6-dimethylphenyl]methanol (PubChem CID 172876855) has the molecular formula C15H14F2O and a molecular weight of 248.27 g/mol. Its IUPAC name is [4-(3,4-difluorophenyl)-2,6-dimethylphenyl]methanol.
| Compound Name | [4-(3,4-difluorophenyl)-2,6-dimethylphenyl]methanol |
|---|---|
| PubChem CID | 172876855 |
| Molecular Formula | C15H14F2O |
| Molecular Weight | 248.27 g/mol |
| Exact Mass | 248.10 |
| IUPAC Name | [4-(3,4-difluorophenyl)-2,6-dimethylphenyl]methanol |
| SMILES | Cc1cc(-c2ccc(F)c(F)c2)cc(C)c1CO |
| InChI | InChI=1S/C15H14F2O/c1-9-5-12(6-10(2)13(9)8-18)11-3-4-14(16)15(17)7-11/h3-7,18H,8H2,1-2H3 |
| InChIKey | VXYOFBJLDJWQML-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.27 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |