C14H12F2O — CID 175668235
[2,6-difluoro-3-(4-methylphenyl)phenyl]methanol (PubChem CID 175668235) has the molecular formula C14H12F2O and a molecular weight of 234.25 g/mol. Its IUPAC name is [2,6-difluoro-3-(4-methylphenyl)phenyl]methanol.
| Compound Name | [2,6-difluoro-3-(4-methylphenyl)phenyl]methanol |
|---|---|
| PubChem CID | 175668235 |
| Molecular Formula | C14H12F2O |
| Molecular Weight | 234.25 g/mol |
| Exact Mass | 234.09 |
| IUPAC Name | [2,6-difluoro-3-(4-methylphenyl)phenyl]methanol |
| SMILES | Cc1ccc(-c2ccc(F)c(CO)c2F)cc1 |
| InChI | InChI=1S/C14H12F2O/c1-9-2-4-10(5-3-9)11-6-7-13(15)12(8-17)14(11)16/h2-7,17H,8H2,1H3 |
| InChIKey | NDBWPGFRFYUOTI-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.25 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |