C9H9F2NO2 — CID 67281170
N-[2,4-difluoro-3-(hydroxymethyl)phenyl]acetamide (PubChem CID 67281170) has the molecular formula C9H9F2NO2 and a molecular weight of 201.17 g/mol. Its IUPAC name is N-[2,4-difluoro-3-(hydroxymethyl)phenyl]acetamide.
| Compound Name | N-[2,4-difluoro-3-(hydroxymethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 67281170 |
| Molecular Formula | C9H9F2NO2 |
| Molecular Weight | 201.17 g/mol |
| Exact Mass | 201.06 |
| IUPAC Name | N-[2,4-difluoro-3-(hydroxymethyl)phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(F)c(CO)c1F |
| InChI | InChI=1S/C9H9F2NO2/c1-5(14)12-8-3-2-7(10)6(4-13)9(8)11/h2-3,13H,4H2,1H3,(H,12,14) |
| InChIKey | HLRZPNKJCRVAHE-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.17 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |