C11H15F2NOSi — CID 101479656
N-(3,4-difluoro-2-trimethylsilylphenyl)acetamide (PubChem CID 101479656) has the molecular formula C11H15F2NOSi and a molecular weight of 243.33 g/mol. Its IUPAC name is N-(3,4-difluoro-2-trimethylsilylphenyl)acetamide.
| Compound Name | N-(3,4-difluoro-2-trimethylsilylphenyl)acetamide |
|---|---|
| PubChem CID | 101479656 |
| Molecular Formula | C11H15F2NOSi |
| Molecular Weight | 243.33 g/mol |
| Exact Mass | 243.09 |
| IUPAC Name | N-(3,4-difluoro-2-trimethylsilylphenyl)acetamide |
| SMILES | CC(=O)Nc1ccc(F)c(F)c1[Si](C)(C)C |
| InChI | InChI=1S/C11H15F2NOSi/c1-7(15)14-9-6-5-8(12)10(13)11(9)16(2,3)4/h5-6H,1-4H3,(H,14,15) |
| InChIKey | BXXBHENSPWQHHA-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.33 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|