C10H14F2SSi — CID 171366311
(2,3-difluoro-6-methylsulfanylphenyl)-trimethylsilane (PubChem CID 171366311) has the molecular formula C10H14F2SSi and a molecular weight of 232.37 g/mol. Its IUPAC name is (2,3-difluoro-6-methylsulfanylphenyl)-trimethylsilane.
| Compound Name | (2,3-difluoro-6-methylsulfanylphenyl)-trimethylsilane |
|---|---|
| PubChem CID | 171366311 |
| Molecular Formula | C10H14F2SSi |
| Molecular Weight | 232.37 g/mol |
| Exact Mass | 232.06 |
| IUPAC Name | (2,3-difluoro-6-methylsulfanylphenyl)-trimethylsilane |
| SMILES | CSc1ccc(F)c(F)c1[Si](C)(C)C |
| InChI | InChI=1S/C10H14F2SSi/c1-13-8-6-5-7(11)9(12)10(8)14(2,3)4/h5-6H,1-4H3 |
| InChIKey | DVGNEJMSJZBQPS-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.37 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|