C11H17FO2S — CID 142524524
3-fluoro-6-methylsulfanylbenzene-1,2-diol;2-methylpropane (PubChem CID 142524524) has the molecular formula C11H17FO2S and a molecular weight of 232.32 g/mol. Its IUPAC name is 3-fluoro-6-methylsulfanylbenzene-1,2-diol;2-methylpropane.
| Compound Name | 3-fluoro-6-methylsulfanylbenzene-1,2-diol;2-methylpropane |
|---|---|
| PubChem CID | 142524524 |
| Molecular Formula | C11H17FO2S |
| Molecular Weight | 232.32 g/mol |
| Exact Mass | 232.09 |
| IUPAC Name | 3-fluoro-6-methylsulfanylbenzene-1,2-diol;2-methylpropane |
| SMILES | CC(C)C.CSc1ccc(F)c(O)c1O |
| InChI | InChI=1S/C7H7FO2S.C4H10/c1-11-5-3-2-4(8)6(9)7(5)10;1-4(2)3/h2-3,9-10H,1H3;4H,1-3H3 |
| InChIKey | WRWBXCPPCNWXPJ-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.32 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|