C10H12F2O2Si — CID 11579522
2,4-difluoro-3-trimethylsilylbenzoic acid (PubChem CID 11579522) has the molecular formula C10H12F2O2Si and a molecular weight of 230.29 g/mol. Its IUPAC name is 2,4-difluoro-3-trimethylsilylbenzoic acid.
| Compound Name | 2,4-difluoro-3-trimethylsilylbenzoic acid |
|---|---|
| PubChem CID | 11579522 |
| Molecular Formula | C10H12F2O2Si |
| Molecular Weight | 230.29 g/mol |
| Exact Mass | 230.06 |
| IUPAC Name | 2,4-difluoro-3-trimethylsilylbenzoic acid |
| SMILES | C[Si](C)(C)c1c(F)ccc(C(=O)O)c1F |
| InChI | InChI=1S/C10H12F2O2Si/c1-15(2,3)9-7(11)5-4-6(8(9)12)10(13)14/h4-5H,1-3H3,(H,13,14) |
| InChIKey | HWVCKUOSSNEHFU-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.29 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|