C9H8F2N2O2 — CID 168651959
N-(2,6-difluoro-3-formamidophenyl)acetamide (PubChem CID 168651959) has the molecular formula C9H8F2N2O2 and a molecular weight of 214.17 g/mol. Its IUPAC name is N-(2,6-difluoro-3-formamidophenyl)acetamide.
| Compound Name | N-(2,6-difluoro-3-formamidophenyl)acetamide |
|---|---|
| PubChem CID | 168651959 |
| Molecular Formula | C9H8F2N2O2 |
| Molecular Weight | 214.17 g/mol |
| Exact Mass | 214.06 |
| IUPAC Name | N-(2,6-difluoro-3-formamidophenyl)acetamide |
| SMILES | CC(=O)Nc1c(F)ccc(NC=O)c1F |
| InChI | InChI=1S/C9H8F2N2O2/c1-5(15)13-9-6(10)2-3-7(8(9)11)12-4-14/h2-4H,1H3,(H,12,14)(H,13,15) |
| InChIKey | BDOHLFVHESEVRI-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.17 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|