C10H8ClF2NO2 — CID 138485796
N-[3-(2-chloroacetyl)-2,6-difluorophenyl]acetamide (PubChem CID 138485796) has the molecular formula C10H8ClF2NO2 and a molecular weight of 247.63 g/mol. Its IUPAC name is N-[3-(2-chloroacetyl)-2,6-difluorophenyl]acetamide.
| Compound Name | N-[3-(2-chloroacetyl)-2,6-difluorophenyl]acetamide |
|---|---|
| PubChem CID | 138485796 |
| Molecular Formula | C10H8ClF2NO2 |
| Molecular Weight | 247.63 g/mol |
| Exact Mass | 247.02 |
| IUPAC Name | N-[3-(2-chloroacetyl)-2,6-difluorophenyl]acetamide |
| SMILES | CC(=O)Nc1c(F)ccc(C(=O)CCl)c1F |
| InChI | InChI=1S/C10H8ClF2NO2/c1-5(15)14-10-7(12)3-2-6(9(10)13)8(16)4-11/h2-3H,4H2,1H3,(H,14,15) |
| InChIKey | UGZUJUMXSIELFJ-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.63 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|