C8H5ClF2O2 — CID 130968300
2-chloro-1-(2,3-difluoro-5-hydroxyphenyl)ethanone (PubChem CID 130968300) has the molecular formula C8H5ClF2O2 and a molecular weight of 206.57 g/mol. Its IUPAC name is 2-chloro-1-(2,3-difluoro-5-hydroxyphenyl)ethanone.
| Compound Name | 2-chloro-1-(2,3-difluoro-5-hydroxyphenyl)ethanone |
|---|---|
| PubChem CID | 130968300 |
| Molecular Formula | C8H5ClF2O2 |
| Molecular Weight | 206.57 g/mol |
| Exact Mass | 205.99 |
| IUPAC Name | 2-chloro-1-(2,3-difluoro-5-hydroxyphenyl)ethanone |
| SMILES | O=C(CCl)c1cc(O)cc(F)c1F |
| InChI | InChI=1S/C8H5ClF2O2/c9-3-7(13)5-1-4(12)2-6(10)8(5)11/h1-2,12H,3H2 |
| InChIKey | QWYPXVGNWFEHEZ-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.57 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|