C8H5F4NO — CID 130006271
N-(2,3,4,6-tetrafluorophenyl)acetamide (PubChem CID 130006271) has the molecular formula C8H5F4NO and a molecular weight of 207.13 g/mol. Its IUPAC name is N-(2,3,4,6-tetrafluorophenyl)acetamide.
| Compound Name | N-(2,3,4,6-tetrafluorophenyl)acetamide |
|---|---|
| PubChem CID | 130006271 |
| Molecular Formula | C8H5F4NO |
| Molecular Weight | 207.13 g/mol |
| Exact Mass | 207.03 |
| IUPAC Name | N-(2,3,4,6-tetrafluorophenyl)acetamide |
| SMILES | CC(=O)Nc1c(F)cc(F)c(F)c1F |
| InChI | InChI=1S/C8H5F4NO/c1-3(14)13-8-5(10)2-4(9)6(11)7(8)12/h2H,1H3,(H,13,14) |
| InChIKey | YYETZNBCTFZKBF-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.13 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|