C9H8Br2FNO2 — CID 86654326
N-(2,4-dibromo-6-fluoro-3-methoxyphenyl)acetamide (PubChem CID 86654326) has the molecular formula C9H8Br2FNO2 and a molecular weight of 340.97 g/mol. Its IUPAC name is N-(2,4-dibromo-6-fluoro-3-methoxyphenyl)acetamide.
| Compound Name | N-(2,4-dibromo-6-fluoro-3-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 86654326 |
| Molecular Formula | C9H8Br2FNO2 |
| Molecular Weight | 340.97 g/mol |
| Exact Mass | 338.89 |
| IUPAC Name | N-(2,4-dibromo-6-fluoro-3-methoxyphenyl)acetamide |
| SMILES | COc1c(Br)cc(F)c(NC(C)=O)c1Br |
| InChI | InChI=1S/C9H8Br2FNO2/c1-4(14)13-8-6(12)3-5(10)9(15-2)7(8)11/h3H,1-2H3,(H,13,14) |
| InChIKey | LMPGLQAAIMTQHG-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.97 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |