C15H16Br2FNO4 — CID 123526182
ethyl 4-(N-acetyl-2,4-dibromo-6-fluoro-3-methoxyanilino)but-2-enoate (PubChem CID 123526182) has the molecular formula C15H16Br2FNO4 and a molecular weight of 453.10 g/mol. Its IUPAC name is ethyl 4-(N-acetyl-2,4-dibromo-6-fluoro-3-methoxyanilino)but-2-enoate.
| Compound Name | ethyl 4-(N-acetyl-2,4-dibromo-6-fluoro-3-methoxyanilino)but-2-enoate |
|---|---|
| PubChem CID | 123526182 |
| Molecular Formula | C15H16Br2FNO4 |
| Molecular Weight | 453.10 g/mol |
| Exact Mass | 450.94 |
| IUPAC Name | ethyl 4-(N-acetyl-2,4-dibromo-6-fluoro-3-methoxyanilino)but-2-enoate |
| SMILES | CCOC(=O)C=CCN(C(C)=O)c1c(F)cc(Br)c(OC)c1Br |
| InChI | InChI=1S/C15H16Br2FNO4/c1-4-23-12(21)6-5-7-19(9(2)20)14-11(18)8-10(16)15(22-3)13(14)17/h5-6,8H,4,7H2,1-3H3 |
| InChIKey | VEIZUQFSGQHJGV-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.10 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|