C22H23FO5P+ — CID 67853144
[(2S)-3-carboxy-2-hydroxypropyl]-[3-[2-(4-fluoro-3-methylphenyl)-4,6-dimethylphenyl]prop-2-ynoxy]-oxophosphanium (PubChem CID 67853144) has the molecular formula C22H23FO5P+ and a molecular weight of 417.39 g/mol. Its IUPAC name is [(2S)-3-carboxy-2-hydroxypropyl]-[3-[2-(4-fluoro-3-methylphenyl)-4,6-dimethylphenyl]prop-2-ynoxy]-oxophosphanium.
| Compound Name | [(2S)-3-carboxy-2-hydroxypropyl]-[3-[2-(4-fluoro-3-methylphenyl)-4,6-dimethylphenyl]prop-2-ynoxy]-oxophosphanium |
|---|---|
| PubChem CID | 67853144 |
| Molecular Formula | C22H23FO5P+ |
| Molecular Weight | 417.39 g/mol |
| Exact Mass | 417.13 |
| IUPAC Name | [(2S)-3-carboxy-2-hydroxypropyl]-[3-[2-(4-fluoro-3-methylphenyl)-4,6-dimethylphenyl]prop-2-ynoxy]-oxophosphanium |
| SMILES | Cc1cc(C)c(C#CCO[P+](=O)C[C@@H](O)CC(=O)O)c(-c2ccc(F)c(C)c2)c1 |
| InChI | InChI=1S/C22H22FO5P/c1-14-9-15(2)19(20(10-14)17-6-7-21(23)16(3)11-17)5-4-8-28-29(27)13-18(24)12-22(25)26/h6-7,9-11,18,24H,8,12-13H2,1-3H3/p+1/t18-/m0/s1 |
| InChIKey | HQOGGWZTLNYYKD-SFHVURJKSA-O |
| XLogP | 4.36 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.39 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|