C33H30FNO5P+ — CID 67735797
[(2S)-3-carboxy-2-hydroxypropyl]-[3-[4-(4-fluorophenyl)-5,6-diphenyl-2-propan-2-yl-3-pyridinyl]prop-2-ynoxy]-oxophosphanium (PubChem CID 67735797) has the molecular formula C33H30FNO5P+ and a molecular weight of 570.58 g/mol. Its IUPAC name is [(2S)-3-carboxy-2-hydroxypropyl]-[3-[4-(4-fluorophenyl)-5,6-diphenyl-2-propan-2-yl-3-pyridinyl]prop-2-ynoxy]-oxophosphanium.
| Compound Name | [(2S)-3-carboxy-2-hydroxypropyl]-[3-[4-(4-fluorophenyl)-5,6-diphenyl-2-propan-2-yl-3-pyridinyl]prop-2-ynoxy]-oxophosphanium |
|---|---|
| PubChem CID | 67735797 |
| Molecular Formula | C33H30FNO5P+ |
| Molecular Weight | 570.58 g/mol |
| Exact Mass | 570.18 |
| IUPAC Name | [(2S)-3-carboxy-2-hydroxypropyl]-[3-[4-(4-fluorophenyl)-5,6-diphenyl-2-propan-2-yl-3-pyridinyl]prop-2-ynoxy]-oxophosphanium |
| SMILES | CC(C)c1nc(-c2ccccc2)c(-c2ccccc2)c(-c2ccc(F)cc2)c1C#CCO[P+](=O)C[C@@H](O)CC(=O)O |
| InChI | InChI=1S/C33H29FNO5P/c1-22(2)32-28(14-9-19-40-41(39)21-27(36)20-29(37)38)30(24-15-17-26(34)18-16-24)31(23-10-5-3-6-11-23)33(35-32)25-12-7-4-8-13-25/h3-8,10-13,15-18,22,27,36H,19-21H2,1-2H3/p+1/t27-/m0/s1 |
| InChIKey | FJKSTQMXQQGQNM-MHZLTWQESA-O |
| XLogP | 7.29 |
| TPSA | 96.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.58 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|