C26H24FNO5P+ — CID 67714818
[4-[2-[4-(4-fluorophenyl)-6-phenyl-2-propan-2-yl-3-pyridinyl]ethynoxy]-2-hydroxy-4-oxobutyl]-hydroxy-oxophosphanium (PubChem CID 67714818) has the molecular formula C26H24FNO5P+ and a molecular weight of 480.45 g/mol. Its IUPAC name is [4-[2-[4-(4-fluorophenyl)-6-phenyl-2-propan-2-yl-3-pyridinyl]ethynoxy]-2-hydroxy-4-oxobutyl]-hydroxy-oxophosphanium.
| Compound Name | [4-[2-[4-(4-fluorophenyl)-6-phenyl-2-propan-2-yl-3-pyridinyl]ethynoxy]-2-hydroxy-4-oxobutyl]-hydroxy-oxophosphanium |
|---|---|
| PubChem CID | 67714818 |
| Molecular Formula | C26H24FNO5P+ |
| Molecular Weight | 480.45 g/mol |
| Exact Mass | 480.14 |
| IUPAC Name | [4-[2-[4-(4-fluorophenyl)-6-phenyl-2-propan-2-yl-3-pyridinyl]ethynoxy]-2-hydroxy-4-oxobutyl]-hydroxy-oxophosphanium |
| SMILES | CC(C)c1nc(-c2ccccc2)cc(-c2ccc(F)cc2)c1C#COC(=O)CC(O)C[P+](=O)O |
| InChI | InChI=1S/C26H23FNO5P/c1-17(2)26-22(12-13-33-25(30)14-21(29)16-34(31)32)23(18-8-10-20(27)11-9-18)15-24(28-26)19-6-4-3-5-7-19/h3-11,15,17,21,29H,14,16H2,1-2H3/p+1 |
| InChIKey | NYRFDRHTRVHOKM-UHFFFAOYSA-O |
| XLogP | 5.02 |
| TPSA | 96.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.45 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|