C33H31FNO5P — CID 15099603
(3S)-4-[2-[6-(2-benzylphenyl)-4-(4-fluorophenyl)-2-propan-2-yl-3-pyridinyl]ethynyl-hydroxyphosphoryl]-3-hydroxybutanoic acid (PubChem CID 15099603) has the molecular formula C33H31FNO5P and a molecular weight of 571.59 g/mol. Its IUPAC name is (3S)-4-[2-[6-(2-benzylphenyl)-4-(4-fluorophenyl)-2-propan-2-yl-3-pyridinyl]ethynyl-hydroxyphosphoryl]-3-hydroxybutanoic acid.
| Compound Name | (3S)-4-[2-[6-(2-benzylphenyl)-4-(4-fluorophenyl)-2-propan-2-yl-3-pyridinyl]ethynyl-hydroxyphosphoryl]-3-hydroxybutanoic acid |
|---|---|
| PubChem CID | 15099603 |
| Molecular Formula | C33H31FNO5P |
| Molecular Weight | 571.59 g/mol |
| Exact Mass | 571.19 |
| IUPAC Name | (3S)-4-[2-[6-(2-benzylphenyl)-4-(4-fluorophenyl)-2-propan-2-yl-3-pyridinyl]ethynyl-hydroxyphosphoryl]-3-hydroxybutanoic acid |
| SMILES | CC(C)c1nc(-c2ccccc2Cc2ccccc2)cc(-c2ccc(F)cc2)c1C#CP(=O)(O)C[C@@H](O)CC(=O)O |
| InChI | InChI=1S/C33H31FNO5P/c1-22(2)33-29(16-17-41(39,40)21-27(36)19-32(37)38)30(24-12-14-26(34)15-13-24)20-31(35-33)28-11-7-6-10-25(28)18-23-8-4-3-5-9-23/h3-15,20,22,27,36H,18-19,21H2,1-2H3,(H,37,38)(H,39,40)/t27-/m0/s1 |
| InChIKey | MZCCCOJEXATGJT-MHZLTWQESA-N |
| XLogP | 6.68 |
| TPSA | 107.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.59 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|