C28H26F2O4 — CID 22842455
(3R,5S)-7-[2,4-bis(4-fluorophenyl)-6-propan-2-ylphenyl]-3,5-dihydroxyhept-6-ynoic acid (PubChem CID 22842455) has the molecular formula C28H26F2O4 and a molecular weight of 464.51 g/mol. Its IUPAC name is (3R,5S)-7-[2,4-bis(4-fluorophenyl)-6-propan-2-ylphenyl]-3,5-dihydroxyhept-6-ynoic acid.
| Compound Name | (3R,5S)-7-[2,4-bis(4-fluorophenyl)-6-propan-2-ylphenyl]-3,5-dihydroxyhept-6-ynoic acid |
|---|---|
| PubChem CID | 22842455 |
| Molecular Formula | C28H26F2O4 |
| Molecular Weight | 464.51 g/mol |
| Exact Mass | 464.18 |
| IUPAC Name | (3R,5S)-7-[2,4-bis(4-fluorophenyl)-6-propan-2-ylphenyl]-3,5-dihydroxyhept-6-ynoic acid |
| SMILES | CC(C)c1cc(-c2ccc(F)cc2)cc(-c2ccc(F)cc2)c1C#C[C@@H](O)C[C@@H](O)CC(=O)O |
| InChI | InChI=1S/C28H26F2O4/c1-17(2)26-13-20(18-3-7-21(29)8-4-18)14-27(19-5-9-22(30)10-6-19)25(26)12-11-23(31)15-24(32)16-28(33)34/h3-10,13-14,17,23-24,31-32H,15-16H2,1-2H3,(H,33,34)/t23-,24-/m1/s1 |
| InChIKey | PMTNJHIIXBQODY-DNQXCXABSA-N |
| XLogP | 5.36 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.51 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|